C19H15N5O3 — CID 122313018
N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]furan-2-carboxamide (PubChem CID 122313018) has the molecular formula C19H15N5O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]furan-2-carboxamide.
| Compound Name | N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 122313018 |
| Molecular Formula | C19H15N5O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]furan-2-carboxamide |
| SMILES | Cc1nc(Oc2ccc(NC(=O)c3ccco3)cc2)cc(-n2ccnc2)n1 |
| InChI | InChI=1S/C19H15N5O3/c1-13-21-17(24-9-8-20-12-24)11-18(22-13)27-15-6-4-14(5-7-15)23-19(25)16-3-2-10-26-16/h2-12H,1H3,(H,23,25) |
| InChIKey | UGOAWFQBJGIBDB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |