C25H19N5O2S — CID 122313238
N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]-4-thiophen-2-ylbenzamide (PubChem CID 122313238) has the molecular formula C25H19N5O2S and a molecular weight of 453.53 g/mol. Its IUPAC name is N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]-4-thiophen-2-ylbenzamide.
| Compound Name | N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]-4-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 122313238 |
| Molecular Formula | C25H19N5O2S |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)oxyphenyl]-4-thiophen-2-ylbenzamide |
| SMILES | Cc1nc(Oc2ccc(NC(=O)c3ccc(-c4cccs4)cc3)cc2)cc(-n2ccnc2)n1 |
| InChI | InChI=1S/C25H19N5O2S/c1-17-27-23(30-13-12-26-16-30)15-24(28-17)32-21-10-8-20(9-11-21)29-25(31)19-6-4-18(5-7-19)22-3-2-14-33-22/h2-16H,1H3,(H,29,31) |
| InChIKey | OMJWLJUOPSZUED-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |