C22H18IN5O2 — CID 122314087
N-[4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]-2-iodobenzamide (PubChem CID 122314087) has the molecular formula C22H18IN5O2 and a molecular weight of 511.32 g/mol. Its IUPAC name is N-[4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]-2-iodobenzamide.
| Compound Name | N-[4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 122314087 |
| Molecular Formula | C22H18IN5O2 |
| Molecular Weight | 511.32 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | N-[4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]-2-iodobenzamide |
| SMILES | Cc1ncn(-c2cc(Oc3ccc(NC(=O)c4ccccc4I)cc3)ncn2)c1C |
| InChI | InChI=1S/C22H18IN5O2/c1-14-15(2)28(13-26-14)20-11-21(25-12-24-20)30-17-9-7-16(8-10-17)27-22(29)18-5-3-4-6-19(18)23/h3-13H,1-2H3,(H,27,29) |
| InChIKey | CJLZIROHAYCSJL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|