C20H16N6O5 — CID 122313887
N-[4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]-5-nitrofuran-2-carboxamide (PubChem CID 122313887) has the molecular formula C20H16N6O5 and a molecular weight of 420.39 g/mol. Its IUPAC name is N-[4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 122313887 |
| Molecular Formula | C20H16N6O5 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-[4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]oxyphenyl]-5-nitrofuran-2-carboxamide |
| SMILES | Cc1ncn(-c2cc(Oc3ccc(NC(=O)c4ccc([N+](=O)[O-])o4)cc3)ncn2)c1C |
| InChI | InChI=1S/C20H16N6O5/c1-12-13(2)25(11-23-12)17-9-18(22-10-21-17)30-15-5-3-14(4-6-15)24-20(27)16-7-8-19(31-16)26(28)29/h3-11H,1-2H3,(H,24,27) |
| InChIKey | CTBXMOXFHFBPOK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|