C15H17BrN4OS — CID 122317877
4-bromo-N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]thiophene-2-carboxamide (PubChem CID 122317877) has the molecular formula C15H17BrN4OS and a molecular weight of 381.30 g/mol. Its IUPAC name is 4-bromo-N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]thiophene-2-carboxamide.
| Compound Name | 4-bromo-N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 122317877 |
| Molecular Formula | C15H17BrN4OS |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 4-bromo-N-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)methyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(N2CCCC2)nc(CNC(=O)c2cc(Br)cs2)n1 |
| InChI | InChI=1S/C15H17BrN4OS/c1-10-6-14(20-4-2-3-5-20)19-13(18-10)8-17-15(21)12-7-11(16)9-22-12/h6-7,9H,2-5,8H2,1H3,(H,17,21) |
| InChIKey | XEQRFFOMDFUGSB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |