C18H20N6O5 — CID 122318432
N-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)methyl]-3,5-dinitrobenzamide (PubChem CID 122318432) has the molecular formula C18H20N6O5 and a molecular weight of 400.40 g/mol. Its IUPAC name is N-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)methyl]-3,5-dinitrobenzamide.
| Compound Name | N-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)methyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 122318432 |
| Molecular Formula | C18H20N6O5 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)methyl]-3,5-dinitrobenzamide |
| SMILES | Cc1cc(N2CCCCC2)nc(CNC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C18H20N6O5/c1-12-7-17(22-5-3-2-4-6-22)21-16(20-12)11-19-18(25)13-8-14(23(26)27)10-15(9-13)24(28)29/h7-10H,2-6,11H2,1H3,(H,19,25) |
| InChIKey | IOOBXKKWGJQXBK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|