C19H24N6O3 — CID 121075047
N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-4-nitrobenzamide (PubChem CID 121075047) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-4-nitrobenzamide.
| Compound Name | N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 121075047 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N-[2-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]ethyl]-4-nitrobenzamide |
| SMILES | Cc1cc(N2CCCCC2)nc(NCCNC(=O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H24N6O3/c1-14-13-17(24-11-3-2-4-12-24)23-19(22-14)21-10-9-20-18(26)15-5-7-16(8-6-15)25(27)28/h5-8,13H,2-4,9-12H2,1H3,(H,20,26)(H,21,22,23) |
| InChIKey | REOWGNHKCYFGIZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|