C19H24N4O2S — CID 122318348
(E)-N-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)methyl]-2-phenylethenesulfonamide (PubChem CID 122318348) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is (E)-N-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)methyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)methyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 122318348 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (E)-N-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)methyl]-2-phenylethenesulfonamide |
| SMILES | Cc1cc(N2CCCCC2)nc(CNS(=O)(=O)/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C19H24N4O2S/c1-16-14-19(23-11-6-3-7-12-23)22-18(21-16)15-20-26(24,25)13-10-17-8-4-2-5-9-17/h2,4-5,8-10,13-14,20H,3,6-7,11-12,15H2,1H3/b13-10+ |
| InChIKey | FUJIJYASIBICAC-JLHYYAGUSA-N |
| XLogP | 2.87 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |