C18H20F3N5O2 — CID 122318452
1-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 122318452) has the molecular formula C18H20F3N5O2 and a molecular weight of 395.39 g/mol. Its IUPAC name is 1-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 122318452 |
| Molecular Formula | C18H20F3N5O2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-[(4-piperidin-1-ylpyrimidin-2-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(NCc1nccc(N2CCCCC2)n1)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C18H20F3N5O2/c19-18(20,21)28-14-7-3-2-6-13(14)24-17(27)23-12-15-22-9-8-16(25-15)26-10-4-1-5-11-26/h2-3,6-9H,1,4-5,10-12H2,(H2,23,24,27) |
| InChIKey | YIDVPRBEDULWNW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |