C15H20N6O2S — CID 122318739
N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]-4-propylthiadiazole-5-carboxamide (PubChem CID 122318739) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]-4-propylthiadiazole-5-carboxamide.
| Compound Name | N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]-4-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 122318739 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]-4-propylthiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)NCc1nccc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H20N6O2S/c1-2-3-11-14(24-20-19-11)15(22)17-10-12-16-5-4-13(18-12)21-6-8-23-9-7-21/h4-5H,2-3,6-10H2,1H3,(H,17,22) |
| InChIKey | VAQPMUMGNNKRHJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |