C19H20N4O4 — CID 122318760
(E)-3-(1,3-benzodioxol-5-yl)-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]prop-2-enamide (PubChem CID 122318760) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 122318760 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NCc1nccc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H20N4O4/c24-19(4-2-14-1-3-15-16(11-14)27-13-26-15)21-12-17-20-6-5-18(22-17)23-7-9-25-10-8-23/h1-6,11H,7-10,12-13H2,(H,21,24)/b4-2+ |
| InChIKey | QCVIBXVXKYNJPP-DUXPYHPUSA-N |
| XLogP | 1.37 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|