C19H27N5OS — CID 122320309
N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-3-(3-methylthiophen-2-yl)propanamide (PubChem CID 122320309) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-3-(3-methylthiophen-2-yl)propanamide.
| Compound Name | N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-3-(3-methylthiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 122320309 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-[4-(dimethylamino)-2-piperidin-1-ylpyrimidin-5-yl]-3-(3-methylthiophen-2-yl)propanamide |
| SMILES | Cc1ccsc1CCC(=O)Nc1cnc(N2CCCCC2)nc1N(C)C |
| InChI | InChI=1S/C19H27N5OS/c1-14-9-12-26-16(14)7-8-17(25)21-15-13-20-19(22-18(15)23(2)3)24-10-5-4-6-11-24/h9,12-13H,4-8,10-11H2,1-3H3,(H,21,25) |
| InChIKey | IHISALALWWVTCD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |