C21H27N5O2 — CID 122321142
1-(2-methoxyphenyl)-N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]cyclopropane-1-carboxamide (PubChem CID 122321142) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(2-methoxyphenyl)-N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 122321142 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-(2-methoxyphenyl)-N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]cyclopropane-1-carboxamide |
| SMILES | COc1ccccc1C1(C(=O)NCCNc2cc(N3CCCC3)cnn2)CC1 |
| InChI | InChI=1S/C21H27N5O2/c1-28-18-7-3-2-6-17(18)21(8-9-21)20(27)23-11-10-22-19-14-16(15-24-25-19)26-12-4-5-13-26/h2-3,6-7,14-15H,4-5,8-13H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | PLKICWNUPXZCEI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|