C20H22N6OS — CID 122321908
1-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 122321908) has the molecular formula C20H22N6OS and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 122321908 |
| Molecular Formula | C20H22N6OS |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)Nc2ccc(Nc3cc(N(C)C)cnn3)cc2)c1 |
| InChI | InChI=1S/C20H22N6OS/c1-26(2)17-12-19(25-21-13-17)22-14-7-9-15(10-8-14)23-20(27)24-16-5-4-6-18(11-16)28-3/h4-13H,1-3H3,(H,22,25)(H2,23,24,27) |
| InChIKey | VRFGMQCFECANJT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |