C21H24N6OS — CID 56921997
1-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 56921997) has the molecular formula C21H24N6OS and a molecular weight of 408.53 g/mol. Its IUPAC name is 1-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 56921997 |
| Molecular Formula | C21H24N6OS |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-[4-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]phenyl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CCNc1nc(C)cc(Nc2ccc(NC(=O)Nc3cccc(SC)c3)cc2)n1 |
| InChI | InChI=1S/C21H24N6OS/c1-4-22-20-23-14(2)12-19(27-20)24-15-8-10-16(11-9-15)25-21(28)26-17-6-5-7-18(13-17)29-3/h5-13H,4H2,1-3H3,(H2,25,26,28)(H2,22,23,24,27) |
| InChIKey | STGVQMWUQMXVQN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |