C19H20N6O2 — CID 122322071
N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-2-methoxypyridine-4-carboxamide (PubChem CID 122322071) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-2-methoxypyridine-4-carboxamide.
| Compound Name | N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-2-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 122322071 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[4-[[5-(dimethylamino)pyridazin-3-yl]amino]phenyl]-2-methoxypyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)Nc2ccc(Nc3cc(N(C)C)cnn3)cc2)ccn1 |
| InChI | InChI=1S/C19H20N6O2/c1-25(2)16-11-17(24-21-12-16)22-14-4-6-15(7-5-14)23-19(26)13-8-9-20-18(10-13)27-3/h4-12H,1-3H3,(H,22,24)(H,23,26) |
| InChIKey | NZBKWVVGTLSTJT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |