C17H25N7O2 — CID 122325476
2-(4,5-dimethyl-6-oxopyrimidin-1-yl)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 122325476) has the molecular formula C17H25N7O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-(4,5-dimethyl-6-oxopyrimidin-1-yl)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | 2-(4,5-dimethyl-6-oxopyrimidin-1-yl)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122325476 |
| Molecular Formula | C17H25N7O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2-(4,5-dimethyl-6-oxopyrimidin-1-yl)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CCNc1nc(C)cc(NCCNC(=O)Cn2cnc(C)c(C)c2=O)n1 |
| InChI | InChI=1S/C17H25N7O2/c1-5-18-17-22-11(2)8-14(23-17)19-6-7-20-15(25)9-24-10-21-13(4)12(3)16(24)26/h8,10H,5-7,9H2,1-4H3,(H,20,25)(H2,18,19,22,23) |
| InChIKey | ZYUBNDADWNCMTD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|