C17H25N5OS — CID 122325522
N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-3-(3-methylthiophen-2-yl)propanamide (PubChem CID 122325522) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-3-(3-methylthiophen-2-yl)propanamide.
| Compound Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-3-(3-methylthiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 122325522 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-3-(3-methylthiophen-2-yl)propanamide |
| SMILES | CCNc1nc(C)cc(NCCNC(=O)CCc2sccc2C)n1 |
| InChI | InChI=1S/C17H25N5OS/c1-4-18-17-21-13(3)11-15(22-17)19-8-9-20-16(23)6-5-14-12(2)7-10-24-14/h7,10-11H,4-6,8-9H2,1-3H3,(H,20,23)(H2,18,19,21,22) |
| InChIKey | LGXUVRDYLQAZPX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|