C14H15NO3S — CID 122331683
(E)-3-(1,3-benzodioxol-5-yl)-1-(2-methyl-1,3-thiazolidin-3-yl)prop-2-en-1-one (PubChem CID 122331683) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-(2-methyl-1,3-thiazolidin-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-(2-methyl-1,3-thiazolidin-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122331683 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-(2-methyl-1,3-thiazolidin-3-yl)prop-2-en-1-one |
| SMILES | CC1SCCN1C(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H15NO3S/c1-10-15(6-7-19-10)14(16)5-3-11-2-4-12-13(8-11)18-9-17-12/h2-5,8,10H,6-7,9H2,1H3/b5-3+ |
| InChIKey | SJTWWZBZSZAYHF-HWKANZROSA-N |
| XLogP | 2.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|