C21H22N2O3 — CID 51266674
(E)-3-(1,3-benzodioxol-5-yl)-1-(4-methyl-2-phenylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 51266674) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-(4-methyl-2-phenylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-(4-methyl-2-phenylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 51266674 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-(4-methyl-2-phenylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | CN1CCN(C(=O)/C=C/c2ccc3c(c2)OCO3)C(c2ccccc2)C1 |
| InChI | InChI=1S/C21H22N2O3/c1-22-11-12-23(18(14-22)17-5-3-2-4-6-17)21(24)10-8-16-7-9-19-20(13-16)26-15-25-19/h2-10,13,18H,11-12,14-15H2,1H3/b10-8+ |
| InChIKey | XZXNRNPDPFRBTC-CSKARUKUSA-N |
| XLogP | 2.94 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|