C21H21NO5S — CID 171130663
3-(1,3-benzodioxol-5-yl)-1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)prop-2-en-1-one (PubChem CID 171130663) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)prop-2-en-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 171130663 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-(1,1-dioxo-7-phenyl-1,4-thiazepan-4-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)N1CCC(c2ccccc2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C21H21NO5S/c23-21(9-7-16-6-8-18-19(14-16)27-15-26-18)22-11-10-20(28(24,25)13-12-22)17-4-2-1-3-5-17/h1-9,14,20H,10-13,15H2 |
| InChIKey | SWWABAXCMOYENB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|