C19H19NO5S2 — CID 129356767
(E)-3-(1,3-benzodioxol-5-yl)-1-[(7S)-1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl]prop-2-en-1-one (PubChem CID 129356767) has the molecular formula C19H19NO5S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-[(7S)-1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[(7S)-1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 129356767 |
| Molecular Formula | C19H19NO5S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[(7S)-1,1-dioxo-7-thiophen-2-yl-1,4-thiazepan-4-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)N1CC[C@@H](c2cccs2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C19H19NO5S2/c21-19(6-4-14-3-5-15-16(12-14)25-13-24-15)20-8-7-18(17-2-1-10-26-17)27(22,23)11-9-20/h1-6,10,12,18H,7-9,11,13H2/b6-4+/t18-/m0/s1 |
| InChIKey | HTHIYTXQGYSPHI-JXTAAOLFSA-N |
| XLogP | 2.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|