C16H20N6O3 — CID 122332267
6-[4-(6-methoxy-2-methylpyrimidin-4-yl)piperazine-1-carbonyl]-2-methylpyridazin-3-one (PubChem CID 122332267) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is 6-[4-(6-methoxy-2-methylpyrimidin-4-yl)piperazine-1-carbonyl]-2-methylpyridazin-3-one.
| Compound Name | 6-[4-(6-methoxy-2-methylpyrimidin-4-yl)piperazine-1-carbonyl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 122332267 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 6-[4-(6-methoxy-2-methylpyrimidin-4-yl)piperazine-1-carbonyl]-2-methylpyridazin-3-one |
| SMILES | COc1cc(N2CCN(C(=O)c3ccc(=O)n(C)n3)CC2)nc(C)n1 |
| InChI | InChI=1S/C16H20N6O3/c1-11-17-13(10-14(18-11)25-3)21-6-8-22(9-7-21)16(24)12-4-5-15(23)20(2)19-12/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | AFCHVWULLOJWIX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |