C16H21N7O2 — CID 122334034
6-[4-[6-(dimethylamino)pyridazin-3-yl]piperazine-1-carbonyl]-2-methylpyridazin-3-one (PubChem CID 122334034) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 6-[4-[6-(dimethylamino)pyridazin-3-yl]piperazine-1-carbonyl]-2-methylpyridazin-3-one.
| Compound Name | 6-[4-[6-(dimethylamino)pyridazin-3-yl]piperazine-1-carbonyl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 122334034 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 6-[4-[6-(dimethylamino)pyridazin-3-yl]piperazine-1-carbonyl]-2-methylpyridazin-3-one |
| SMILES | CN(C)c1ccc(N2CCN(C(=O)c3ccc(=O)n(C)n3)CC2)nn1 |
| InChI | InChI=1S/C16H21N7O2/c1-20(2)13-5-6-14(18-17-13)22-8-10-23(11-9-22)16(25)12-4-7-15(24)21(3)19-12/h4-7H,8-11H2,1-3H3 |
| InChIKey | QTXXAJDOZWMFBH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 87.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |