C19H22N8O — CID 122334029
[4-[6-(dimethylamino)pyridazin-3-yl]piperazin-1-yl]-(2-phenyltriazol-4-yl)methanone (PubChem CID 122334029) has the molecular formula C19H22N8O and a molecular weight of 378.44 g/mol. Its IUPAC name is [4-[6-(dimethylamino)pyridazin-3-yl]piperazin-1-yl]-(2-phenyltriazol-4-yl)methanone.
| Compound Name | [4-[6-(dimethylamino)pyridazin-3-yl]piperazin-1-yl]-(2-phenyltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 122334029 |
| Molecular Formula | C19H22N8O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [4-[6-(dimethylamino)pyridazin-3-yl]piperazin-1-yl]-(2-phenyltriazol-4-yl)methanone |
| SMILES | CN(C)c1ccc(N2CCN(C(=O)c3cnn(-c4ccccc4)n3)CC2)nn1 |
| InChI | InChI=1S/C19H22N8O/c1-24(2)17-8-9-18(22-21-17)25-10-12-26(13-11-25)19(28)16-14-20-27(23-16)15-6-4-3-5-7-15/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | LHGGAGZSWPYPLE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |