C22H26N8O — CID 122344085
(2-phenyltriazol-4-yl)-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 122344085) has the molecular formula C22H26N8O and a molecular weight of 418.51 g/mol. Its IUPAC name is (2-phenyltriazol-4-yl)-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (2-phenyltriazol-4-yl)-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122344085 |
| Molecular Formula | C22H26N8O |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (2-phenyltriazol-4-yl)-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cnn(-c2ccccc2)n1)N1CCN(c2ccnc(N3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C22H26N8O/c31-21(19-17-24-30(26-19)18-7-3-1-4-8-18)28-15-13-27(14-16-28)20-9-10-23-22(25-20)29-11-5-2-6-12-29/h1,3-4,7-10,17H,2,5-6,11-16H2 |
| InChIKey | DZZMLVNRECJIKE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |