C19H24N4O3 — CID 122332287
1-[4-(6-methoxy-2-methylpyrimidin-4-yl)piperazin-1-yl]-2-(4-methylphenoxy)ethanone (PubChem CID 122332287) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-[4-(6-methoxy-2-methylpyrimidin-4-yl)piperazin-1-yl]-2-(4-methylphenoxy)ethanone.
| Compound Name | 1-[4-(6-methoxy-2-methylpyrimidin-4-yl)piperazin-1-yl]-2-(4-methylphenoxy)ethanone |
|---|---|
| PubChem CID | 122332287 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-[4-(6-methoxy-2-methylpyrimidin-4-yl)piperazin-1-yl]-2-(4-methylphenoxy)ethanone |
| SMILES | COc1cc(N2CCN(C(=O)COc3ccc(C)cc3)CC2)nc(C)n1 |
| InChI | InChI=1S/C19H24N4O3/c1-14-4-6-16(7-5-14)26-13-19(24)23-10-8-22(9-11-23)17-12-18(25-3)21-15(2)20-17/h4-7,12H,8-11,13H2,1-3H3 |
| InChIKey | GEZUCOBJCMSWHD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |