C15H18N4O3S — CID 136540505
1-[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]-2-thiophen-3-yloxyethanone (PubChem CID 136540505) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]-2-thiophen-3-yloxyethanone.
| Compound Name | 1-[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]-2-thiophen-3-yloxyethanone |
|---|---|
| PubChem CID | 136540505 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-[4-(6-methoxypyrimidin-4-yl)piperazin-1-yl]-2-thiophen-3-yloxyethanone |
| SMILES | COc1cc(N2CCN(C(=O)COc3ccsc3)CC2)ncn1 |
| InChI | InChI=1S/C15H18N4O3S/c1-21-14-8-13(16-11-17-14)18-3-5-19(6-4-18)15(20)9-22-12-2-7-23-10-12/h2,7-8,10-11H,3-6,9H2,1H3 |
| InChIKey | JBSUOSNYKDOTCW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |