C17H20BrN5O2S — CID 122335278
(4-bromothiophen-2-yl)-[4-(6-morpholin-4-ylpyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 122335278) has the molecular formula C17H20BrN5O2S and a molecular weight of 438.35 g/mol. Its IUPAC name is (4-bromothiophen-2-yl)-[4-(6-morpholin-4-ylpyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | (4-bromothiophen-2-yl)-[4-(6-morpholin-4-ylpyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122335278 |
| Molecular Formula | C17H20BrN5O2S |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | (4-bromothiophen-2-yl)-[4-(6-morpholin-4-ylpyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Br)cs1)N1CCN(c2ccc(N3CCOCC3)nn2)CC1 |
| InChI | InChI=1S/C17H20BrN5O2S/c18-13-11-14(26-12-13)17(24)23-5-3-21(4-6-23)15-1-2-16(20-19-15)22-7-9-25-10-8-22/h1-2,11-12H,3-10H2 |
| InChIKey | DLTFXNBVPGNWSF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |