C17H16BrN5OS — CID 122341630
(4-bromothiophen-2-yl)-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 122341630) has the molecular formula C17H16BrN5OS and a molecular weight of 418.32 g/mol. Its IUPAC name is (4-bromothiophen-2-yl)-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | (4-bromothiophen-2-yl)-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122341630 |
| Molecular Formula | C17H16BrN5OS |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | (4-bromothiophen-2-yl)-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Br)cs1)N1CCN(c2ccc(-n3cccc3)nn2)CC1 |
| InChI | InChI=1S/C17H16BrN5OS/c18-13-11-14(25-12-13)17(24)23-9-7-22(8-10-23)16-4-3-15(19-20-16)21-5-1-2-6-21/h1-6,11-12H,7-10H2 |
| InChIKey | BNYRIMCPRLPHDW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |