C20H27FN6O — CID 122335449
4-[6-(diethylamino)pyridazin-3-yl]-N-(3-fluoro-4-methylphenyl)piperazine-1-carboxamide (PubChem CID 122335449) has the molecular formula C20H27FN6O and a molecular weight of 386.48 g/mol. Its IUPAC name is 4-[6-(diethylamino)pyridazin-3-yl]-N-(3-fluoro-4-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[6-(diethylamino)pyridazin-3-yl]-N-(3-fluoro-4-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122335449 |
| Molecular Formula | C20H27FN6O |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 4-[6-(diethylamino)pyridazin-3-yl]-N-(3-fluoro-4-methylphenyl)piperazine-1-carboxamide |
| SMILES | CCN(CC)c1ccc(N2CCN(C(=O)Nc3ccc(C)c(F)c3)CC2)nn1 |
| InChI | InChI=1S/C20H27FN6O/c1-4-25(5-2)18-8-9-19(24-23-18)26-10-12-27(13-11-26)20(28)22-16-7-6-15(3)17(21)14-16/h6-9,14H,4-5,10-13H2,1-3H3,(H,22,28) |
| InChIKey | PURKDJWGMBEPFE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |