C18H23FN6O — CID 122335628
[4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]-(5-fluoro-3-pyridinyl)methanone (PubChem CID 122335628) has the molecular formula C18H23FN6O and a molecular weight of 358.42 g/mol. Its IUPAC name is [4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]-(5-fluoro-3-pyridinyl)methanone.
| Compound Name | [4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]-(5-fluoro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 122335628 |
| Molecular Formula | C18H23FN6O |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]-(5-fluoro-3-pyridinyl)methanone |
| SMILES | CCN(CC)c1ccc(N2CCN(C(=O)c3cncc(F)c3)CC2)nn1 |
| InChI | InChI=1S/C18H23FN6O/c1-3-23(4-2)16-5-6-17(22-21-16)24-7-9-25(10-8-24)18(26)14-11-15(19)13-20-12-14/h5-6,11-13H,3-4,7-10H2,1-2H3 |
| InChIKey | FJWLDSBROLLJHA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 65.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |