C19H26N6O2 — CID 122335617
[4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]-(2-methoxy-4-pyridinyl)methanone (PubChem CID 122335617) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is [4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]-(2-methoxy-4-pyridinyl)methanone.
| Compound Name | [4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]-(2-methoxy-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 122335617 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]-(2-methoxy-4-pyridinyl)methanone |
| SMILES | CCN(CC)c1ccc(N2CCN(C(=O)c3ccnc(OC)c3)CC2)nn1 |
| InChI | InChI=1S/C19H26N6O2/c1-4-23(5-2)16-6-7-17(22-21-16)24-10-12-25(13-11-24)19(26)15-8-9-20-18(14-15)27-3/h6-9,14H,4-5,10-13H2,1-3H3 |
| InChIKey | NHFDEGARMYYZRX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |