C19H24BrN5O — CID 121053372
(4-bromophenyl)-[4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]methanone (PubChem CID 121053372) has the molecular formula C19H24BrN5O and a molecular weight of 418.34 g/mol. Its IUPAC name is (4-bromophenyl)-[4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]methanone.
| Compound Name | (4-bromophenyl)-[4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121053372 |
| Molecular Formula | C19H24BrN5O |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (4-bromophenyl)-[4-[6-(diethylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
| SMILES | CCN(CC)c1ccc(N2CCN(C(=O)c3ccc(Br)cc3)CC2)nn1 |
| InChI | InChI=1S/C19H24BrN5O/c1-3-23(4-2)17-9-10-18(22-21-17)24-11-13-25(14-12-24)19(26)15-5-7-16(20)8-6-15/h5-10H,3-4,11-14H2,1-2H3 |
| InChIKey | INQAJEUGKUJICR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |