C16H16N6O2 — CID 122338270
furan-3-yl-[4-(6-imidazol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 122338270) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is furan-3-yl-[4-(6-imidazol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | furan-3-yl-[4-(6-imidazol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122338270 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | furan-3-yl-[4-(6-imidazol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccoc1)N1CCN(c2cc(-n3ccnc3)ncn2)CC1 |
| InChI | InChI=1S/C16H16N6O2/c23-16(13-1-8-24-10-13)21-6-4-20(5-7-21)14-9-15(19-11-18-14)22-3-2-17-12-22/h1-3,8-12H,4-7H2 |
| InChIKey | QCDMWTCSVYDAOD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |