C25H24N6O — CID 121073739
1-[4-(6-imidazol-1-ylpyrimidin-4-yl)piperazin-1-yl]-2,2-diphenylethanone (PubChem CID 121073739) has the molecular formula C25H24N6O and a molecular weight of 424.51 g/mol. Its IUPAC name is 1-[4-(6-imidazol-1-ylpyrimidin-4-yl)piperazin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-(6-imidazol-1-ylpyrimidin-4-yl)piperazin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 121073739 |
| Molecular Formula | C25H24N6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-[4-(6-imidazol-1-ylpyrimidin-4-yl)piperazin-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCN(c2cc(-n3ccnc3)ncn2)CC1 |
| InChI | InChI=1S/C25H24N6O/c32-25(24(20-7-3-1-4-8-20)21-9-5-2-6-10-21)30-15-13-29(14-16-30)22-17-23(28-18-27-22)31-12-11-26-19-31/h1-12,17-19,24H,13-16H2 |
| InChIKey | AKFCCZYPXYLJPV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |