C23H27N7O — CID 90520235
[1-(6-imidazol-1-ylpyrimidin-4-yl)piperidin-4-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 90520235) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is [1-(6-imidazol-1-ylpyrimidin-4-yl)piperidin-4-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [1-(6-imidazol-1-ylpyrimidin-4-yl)piperidin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 90520235 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [1-(6-imidazol-1-ylpyrimidin-4-yl)piperidin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | O=C(C1CCN(c2cc(-n3ccnc3)ncn2)CC1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H27N7O/c31-23(29-14-12-27(13-15-29)20-4-2-1-3-5-20)19-6-9-28(10-7-19)21-16-22(26-17-25-21)30-11-8-24-18-30/h1-5,8,11,16-19H,6-7,9-10,12-15H2 |
| InChIKey | AZWHOQBCAPRWNV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |