C23H27N7O — CID 90514724
[1-(6-imidazol-1-ylpyridazin-3-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 90514724) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is [1-(6-imidazol-1-ylpyridazin-3-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [1-(6-imidazol-1-ylpyridazin-3-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 90514724 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [1-(6-imidazol-1-ylpyridazin-3-yl)piperidin-3-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | O=C(C1CCCN(c2ccc(-n3ccnc3)nn2)C1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H27N7O/c31-23(28-15-13-27(14-16-28)20-6-2-1-3-7-20)19-5-4-11-29(17-19)21-8-9-22(26-25-21)30-12-10-24-18-30/h1-3,6-10,12,18-19H,4-5,11,13-17H2 |
| InChIKey | AFPXJLRDOGDCKJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |