C18H17FN6O — CID 122342101
(3-fluoro-4-pyridinyl)-[4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 122342101) has the molecular formula C18H17FN6O and a molecular weight of 352.37 g/mol. Its IUPAC name is (3-fluoro-4-pyridinyl)-[4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (3-fluoro-4-pyridinyl)-[4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122342101 |
| Molecular Formula | C18H17FN6O |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (3-fluoro-4-pyridinyl)-[4-(6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccncc1F)N1CCN(c2cc(-n3cccc3)ncn2)CC1 |
| InChI | InChI=1S/C18H17FN6O/c19-15-12-20-4-3-14(15)18(26)25-9-7-24(8-10-25)17-11-16(21-13-22-17)23-5-1-2-6-23/h1-6,11-13H,7-10H2 |
| InChIKey | YAOLGFTZVYYHEQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |