C22H29N5O3 — CID 122344106
2-(3-methoxyphenoxy)-1-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]ethanone (PubChem CID 122344106) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-(3-methoxyphenoxy)-1-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3-methoxyphenoxy)-1-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122344106 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 2-(3-methoxyphenoxy)-1-[4-(2-piperidin-1-ylpyrimidin-4-yl)piperazin-1-yl]ethanone |
| SMILES | COc1cccc(OCC(=O)N2CCN(c3ccnc(N4CCCCC4)n3)CC2)c1 |
| InChI | InChI=1S/C22H29N5O3/c1-29-18-6-5-7-19(16-18)30-17-21(28)26-14-12-25(13-15-26)20-8-9-23-22(24-20)27-10-3-2-4-11-27/h5-9,16H,2-4,10-15,17H2,1H3 |
| InChIKey | BNFQLMGVWBNGCL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |