C24H30N6O — CID 122347614
1-adamantyl-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone (PubChem CID 122347614) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 1-adamantyl-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone.
| Compound Name | 1-adamantyl-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122347614 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 1-adamantyl-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
| SMILES | O=C(N1CCN(c2ccc(Nc3cccnc3)nn2)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H30N6O/c31-23(24-13-17-10-18(14-24)12-19(11-17)15-24)30-8-6-29(7-9-30)22-4-3-21(27-28-22)26-20-2-1-5-25-16-20/h1-5,16-19H,6-15H2,(H,26,27) |
| InChIKey | ZZQXMHBMSWDDHV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |