C25H28N6O2 — CID 122347595
(4-phenyloxan-4-yl)-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone (PubChem CID 122347595) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is (4-phenyloxan-4-yl)-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone.
| Compound Name | (4-phenyloxan-4-yl)-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122347595 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (4-phenyloxan-4-yl)-[4-[6-(pyridin-3-ylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
| SMILES | O=C(N1CCN(c2ccc(Nc3cccnc3)nn2)CC1)C1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C25H28N6O2/c32-24(25(10-17-33-18-11-25)20-5-2-1-3-6-20)31-15-13-30(14-16-31)23-9-8-22(28-29-23)27-21-7-4-12-26-19-21/h1-9,12,19H,10-11,13-18H2,(H,27,28) |
| InChIKey | IHOAKMKLCSYTQF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |