C24H28N6O2 — CID 121113860
[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(4-phenyloxan-4-yl)methanone (PubChem CID 121113860) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is [4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(4-phenyloxan-4-yl)methanone.
| Compound Name | [4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(4-phenyloxan-4-yl)methanone |
|---|---|
| PubChem CID | 121113860 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(4-phenyloxan-4-yl)methanone |
| SMILES | Cc1nccn1-c1ccc(N2CCN(C(=O)C3(c4ccccc4)CCOCC3)CC2)nn1 |
| InChI | InChI=1S/C24H28N6O2/c1-19-25-11-12-30(19)22-8-7-21(26-27-22)28-13-15-29(16-14-28)23(31)24(9-17-32-18-10-24)20-5-3-2-4-6-20/h2-8,11-12H,9-10,13-18H2,1H3 |
| InChIKey | AWJCWSFEMGIOSF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |