C26H35N5O2 — CID 122333244
[4-(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)piperazin-1-yl]-(4-phenyloxan-4-yl)methanone (PubChem CID 122333244) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is [4-(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)piperazin-1-yl]-(4-phenyloxan-4-yl)methanone.
| Compound Name | [4-(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)piperazin-1-yl]-(4-phenyloxan-4-yl)methanone |
|---|---|
| PubChem CID | 122333244 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | [4-(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)piperazin-1-yl]-(4-phenyloxan-4-yl)methanone |
| SMILES | Cc1cc(N2CCCCC2)nc(N2CCN(C(=O)C3(c4ccccc4)CCOCC3)CC2)n1 |
| InChI | InChI=1S/C26H35N5O2/c1-21-20-23(29-12-6-3-7-13-29)28-25(27-21)31-16-14-30(15-17-31)24(32)26(10-18-33-19-11-26)22-8-4-2-5-9-22/h2,4-5,8-9,20H,3,6-7,10-19H2,1H3 |
| InChIKey | TUHZECPLZRCPLN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |