C21H22N6O2S — CID 122347759
6-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-N-pyridin-3-ylpyridazin-3-amine (PubChem CID 122347759) has the molecular formula C21H22N6O2S and a molecular weight of 422.51 g/mol. Its IUPAC name is 6-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-N-pyridin-3-ylpyridazin-3-amine.
| Compound Name | 6-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-N-pyridin-3-ylpyridazin-3-amine |
|---|---|
| PubChem CID | 122347759 |
| Molecular Formula | C21H22N6O2S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 6-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-N-pyridin-3-ylpyridazin-3-amine |
| SMILES | O=S(=O)(/C=C/c1ccccc1)N1CCN(c2ccc(Nc3cccnc3)nn2)CC1 |
| InChI | InChI=1S/C21H22N6O2S/c28-30(29,16-10-18-5-2-1-3-6-18)27-14-12-26(13-15-27)21-9-8-20(24-25-21)23-19-7-4-11-22-17-19/h1-11,16-17H,12-15H2,(H,23,24)/b16-10+ |
| InChIKey | DOBPEKBESQCEQH-MHWRWJLKSA-N |
| XLogP | 2.74 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |