C25H25N7O — CID 122348779
[4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl]-quinoxalin-6-ylmethanone (PubChem CID 122348779) has the molecular formula C25H25N7O and a molecular weight of 439.52 g/mol. Its IUPAC name is [4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl]-quinoxalin-6-ylmethanone.
| Compound Name | [4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl]-quinoxalin-6-ylmethanone |
|---|---|
| PubChem CID | 122348779 |
| Molecular Formula | C25H25N7O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | [4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl]-quinoxalin-6-ylmethanone |
| SMILES | Cc1ccc(Nc2cc(N3CCN(C(=O)c4ccc5nccnc5c4)CC3)nc(C)n2)cc1 |
| InChI | InChI=1S/C25H25N7O/c1-17-3-6-20(7-4-17)30-23-16-24(29-18(2)28-23)31-11-13-32(14-12-31)25(33)19-5-8-21-22(15-19)27-10-9-26-21/h3-10,15-16H,11-14H2,1-2H3,(H,28,29,30) |
| InChIKey | GMOKHPAYRHLELY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |