C22H23IN6O — CID 122350540
(4-iodophenyl)-[4-[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 122350540) has the molecular formula C22H23IN6O and a molecular weight of 514.37 g/mol. Its IUPAC name is (4-iodophenyl)-[4-[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (4-iodophenyl)-[4-[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122350540 |
| Molecular Formula | C22H23IN6O |
| Molecular Weight | 514.37 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | (4-iodophenyl)-[4-[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | Cc1ccnc(Nc2cc(N3CCN(C(=O)c4ccc(I)cc4)CC3)nc(C)n2)c1 |
| InChI | InChI=1S/C22H23IN6O/c1-15-7-8-24-19(13-15)27-20-14-21(26-16(2)25-20)28-9-11-29(12-10-28)22(30)17-3-5-18(23)6-4-17/h3-8,13-14H,9-12H2,1-2H3,(H,24,25,26,27) |
| InChIKey | QYHXJGSGHVMCTB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|