C22H22N8O5 — CID 122350545
(3,5-dinitrophenyl)-[4-[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 122350545) has the molecular formula C22H22N8O5 and a molecular weight of 478.47 g/mol. Its IUPAC name is (3,5-dinitrophenyl)-[4-[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (3,5-dinitrophenyl)-[4-[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122350545 |
| Molecular Formula | C22H22N8O5 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (3,5-dinitrophenyl)-[4-[2-methyl-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | Cc1ccnc(Nc2cc(N3CCN(C(=O)c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4)CC3)nc(C)n2)c1 |
| InChI | InChI=1S/C22H22N8O5/c1-14-3-4-23-19(9-14)26-20-13-21(25-15(2)24-20)27-5-7-28(8-6-27)22(31)16-10-17(29(32)33)12-18(11-16)30(34)35/h3-4,9-13H,5-8H2,1-2H3,(H,23,24,25,26) |
| InChIKey | OWQMZBQSEKOKOF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 160.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|