C22H24N6O2 — CID 122349075
2-(2-methylphenoxy)-1-[4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]ethanone (PubChem CID 122349075) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-(2-methylphenoxy)-1-[4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2-methylphenoxy)-1-[4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122349075 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-(2-methylphenoxy)-1-[4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]ethanone |
| SMILES | Cc1ccccc1OCC(=O)N1CCN(c2cc(Nc3ccccn3)ncn2)CC1 |
| InChI | InChI=1S/C22H24N6O2/c1-17-6-2-3-7-18(17)30-15-22(29)28-12-10-27(11-13-28)21-14-20(24-16-25-21)26-19-8-4-5-9-23-19/h2-9,14,16H,10-13,15H2,1H3,(H,23,24,25,26) |
| InChIKey | XQSVBMDYBPSOQF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |