C20H19IN6O — CID 122349291
(4-iodophenyl)-[4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 122349291) has the molecular formula C20H19IN6O and a molecular weight of 486.32 g/mol. Its IUPAC name is (4-iodophenyl)-[4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (4-iodophenyl)-[4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122349291 |
| Molecular Formula | C20H19IN6O |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | (4-iodophenyl)-[4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(I)cc1)N1CCN(c2cc(Nc3ccccn3)ncn2)CC1 |
| InChI | InChI=1S/C20H19IN6O/c21-16-6-4-15(5-7-16)20(28)27-11-9-26(10-12-27)19-13-18(23-14-24-19)25-17-3-1-2-8-22-17/h1-8,13-14H,9-12H2,(H,22,23,24,25) |
| InChIKey | OPWAFSWVZGWDOV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|